C26H22ClN3 — CID 102048271
6-(4-tert-butylphenyl)-4-(4-chlorophenyl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 102048271) has the molecular formula C26H22ClN3 and a molecular weight of 411.94 g/mol. Its IUPAC name is 6-(4-tert-butylphenyl)-4-(4-chlorophenyl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 6-(4-tert-butylphenyl)-4-(4-chlorophenyl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 102048271 |
| Molecular Formula | C26H22ClN3 |
| Molecular Weight | 411.94 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 6-(4-tert-butylphenyl)-4-(4-chlorophenyl)-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | CC(C)(C)c1ccc(-c2cc(-c3ccc(Cl)cc3)nc3c2[nH]c2ncccc23)cc1 |
| InChI | InChI=1S/C26H22ClN3/c1-26(2,3)18-10-6-16(7-11-18)21-15-22(17-8-12-19(27)13-9-17)29-23-20-5-4-14-28-25(20)30-24(21)23/h4-15H,1-3H3,(H,28,30) |
| InChIKey | RKKFQBZTEUVSMP-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.94 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |