C16H11N3 — CID 15319205
6-phenyl-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 15319205) has the molecular formula C16H11N3 and a molecular weight of 245.29 g/mol. Its IUPAC name is 6-phenyl-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 6-phenyl-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 15319205 |
| Molecular Formula | C16H11N3 |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 6-phenyl-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | c1ccc(-c2ccnc3c2[nH]c2ncccc23)cc1 |
| InChI | InChI=1S/C16H11N3/c1-2-5-11(6-3-1)12-8-10-17-14-13-7-4-9-18-16(13)19-15(12)14/h1-10H,(H,18,19) |
| InChIKey | GEEARZBVBSWJGF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |