C14H10N2 — CID 21147452
4-phenyl-1,8-naphthyridine (PubChem CID 21147452) has the molecular formula C14H10N2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 4-phenyl-1,8-naphthyridine.
| Compound Name | 4-phenyl-1,8-naphthyridine |
|---|---|
| PubChem CID | 21147452 |
| Molecular Formula | C14H10N2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 4-phenyl-1,8-naphthyridine |
| SMILES | c1ccc(-c2ccnc3ncccc23)cc1 |
| InChI | InChI=1S/C14H10N2/c1-2-5-11(6-3-1)12-8-10-16-14-13(12)7-4-9-15-14/h1-10H |
| InChIKey | PMGTWCDVKICTAE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |