C15H13BNO2 — CID 175088616
CID 175088616 (PubChem CID 175088616) has the molecular formula C15H13BNO2 and a molecular weight of 250.09 g/mol.
| Compound Name | CID 175088616 |
|---|---|
| PubChem CID | 175088616 |
| Molecular Formula | C15H13BNO2 |
| Molecular Weight | 250.09 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | — |
| SMILES | O[B]O.c1ccc(-c2cccc3ncccc23)cc1 |
| InChI | InChI=1S/C15H11N.BH2O2/c1-2-6-12(7-3-1)13-8-4-10-15-14(13)9-5-11-16-15;2-1-3/h1-11H;2-3H |
| InChIKey | HGYICCVCCBSWFF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.09 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|