C16H18N2Si — CID 86188876
trimethyl-(3-phenyl-1H-pyrrolo[2,3-b]pyridin-2-yl)silane (PubChem CID 86188876) has the molecular formula C16H18N2Si and a molecular weight of 266.42 g/mol. Its IUPAC name is trimethyl-(3-phenyl-1H-pyrrolo[2,3-b]pyridin-2-yl)silane.
| Compound Name | trimethyl-(3-phenyl-1H-pyrrolo[2,3-b]pyridin-2-yl)silane |
|---|---|
| PubChem CID | 86188876 |
| Molecular Formula | C16H18N2Si |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | trimethyl-(3-phenyl-1H-pyrrolo[2,3-b]pyridin-2-yl)silane |
| SMILES | C[Si](C)(C)c1[nH]c2ncccc2c1-c1ccccc1 |
| InChI | InChI=1S/C16H18N2Si/c1-19(2,3)16-14(12-8-5-4-6-9-12)13-10-7-11-17-15(13)18-16/h4-11H,1-3H3,(H,17,18) |
| InChIKey | QFBBFRNTJWMXJN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|