C23H16N2O — CID 175499202
dibenzofuran;9H-pyrido[2,3-b]indole (PubChem CID 175499202) has the molecular formula C23H16N2O and a molecular weight of 336.39 g/mol. Its IUPAC name is dibenzofuran;9H-pyrido[2,3-b]indole.
| Compound Name | dibenzofuran;9H-pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 175499202 |
| Molecular Formula | C23H16N2O |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | dibenzofuran;9H-pyrido[2,3-b]indole |
| SMILES | c1ccc2c(c1)[nH]c1ncccc12.c1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C12H8O.C11H8N2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2-6-10-8(4-1)9-5-3-7-12-11(9)13-10/h1-8H;1-7H,(H,12,13) |
| InChIKey | LLUZCZLJFIJDDK-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |