C22H13N3O — CID 137392078
5-dibenzofuran-3-yl-3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 137392078) has the molecular formula C22H13N3O and a molecular weight of 335.37 g/mol. Its IUPAC name is 5-dibenzofuran-3-yl-3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 5-dibenzofuran-3-yl-3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 137392078 |
| Molecular Formula | C22H13N3O |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 5-dibenzofuran-3-yl-3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | c1cnc2c(c1)[nH]c1cc(-c3ccc4c(c3)oc3ccccc34)cnc12 |
| InChI | InChI=1S/C22H13N3O/c1-2-6-19-15(4-1)16-8-7-13(11-20(16)26-19)14-10-18-22(24-12-14)21-17(25-18)5-3-9-23-21/h1-12,25H |
| InChIKey | PFMCUPSVDOQWTO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |