C11H8N2O — CID 67086557
9H-pyrido[2,3-b]indol-7-ol (PubChem CID 67086557) has the molecular formula C11H8N2O and a molecular weight of 184.20 g/mol. Its IUPAC name is 9H-pyrido[2,3-b]indol-7-ol.
| Compound Name | 9H-pyrido[2,3-b]indol-7-ol |
|---|---|
| PubChem CID | 67086557 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 9H-pyrido[2,3-b]indol-7-ol |
| SMILES | Oc1ccc2c(c1)[nH]c1ncccc12 |
| InChI | InChI=1S/C11H8N2O/c14-7-3-4-8-9-2-1-5-12-11(9)13-10(8)6-7/h1-6,14H,(H,12,13) |
| InChIKey | CKPNYHOHCLLSAP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |