C15H10N4 — CID 44548154
4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 44548154) has the molecular formula C15H10N4 and a molecular weight of 246.27 g/mol. Its IUPAC name is 4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 44548154 |
| Molecular Formula | C15H10N4 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | c1cncc(-c2cc3c(cn2)[nH]c2ncccc23)c1 |
| InChI | InChI=1S/C15H10N4/c1-3-10(8-16-5-1)13-7-12-11-4-2-6-17-15(11)19-14(12)9-18-13/h1-9H,(H,17,19) |
| InChIKey | BSOGMLLOWDWVAL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |