C23H19N5O — CID 67320105
2-[3-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)phenoxy]ethanamine (PubChem CID 67320105) has the molecular formula C23H19N5O and a molecular weight of 381.44 g/mol. Its IUPAC name is 2-[3-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)phenoxy]ethanamine.
| Compound Name | 2-[3-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)phenoxy]ethanamine |
|---|---|
| PubChem CID | 67320105 |
| Molecular Formula | C23H19N5O |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-[3-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)phenoxy]ethanamine |
| SMILES | NCCOc1cccc(-c2cnc3[nH]c4cnc(-c5cccnc5)cc4c3c2)c1 |
| InChI | InChI=1S/C23H19N5O/c24-6-8-29-18-5-1-3-15(9-18)17-10-20-19-11-21(16-4-2-7-25-12-16)26-14-22(19)28-23(20)27-13-17/h1-5,7,9-14H,6,8,24H2,(H,27,28) |
| InChIKey | AIMOZLVFWQPAFV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |