C20H19N5 — CID 58354665
12-piperidin-1-yl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 58354665) has the molecular formula C20H19N5 and a molecular weight of 329.41 g/mol. Its IUPAC name is 12-piperidin-1-yl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 12-piperidin-1-yl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 58354665 |
| Molecular Formula | C20H19N5 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 12-piperidin-1-yl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | c1cncc(-c2cc3c(cn2)[nH]c2ncc(N4CCCCC4)cc23)c1 |
| InChI | InChI=1S/C20H19N5/c1-2-7-25(8-3-1)15-9-17-16-10-18(14-5-4-6-21-11-14)22-13-19(16)24-20(17)23-12-15/h4-6,9-13H,1-3,7-8H2,(H,23,24) |
| InChIKey | JKPJFAQGSAOTKT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |