C29H30N6O3S — CID 58354638
12-[4-[3-(4-methylsulfonylpiperazin-1-yl)propoxy]phenyl]-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 58354638) has the molecular formula C29H30N6O3S and a molecular weight of 542.67 g/mol. Its IUPAC name is 12-[4-[3-(4-methylsulfonylpiperazin-1-yl)propoxy]phenyl]-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 12-[4-[3-(4-methylsulfonylpiperazin-1-yl)propoxy]phenyl]-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 58354638 |
| Molecular Formula | C29H30N6O3S |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | 12-[4-[3-(4-methylsulfonylpiperazin-1-yl)propoxy]phenyl]-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | CS(=O)(=O)N1CCN(CCCOc2ccc(-c3cnc4[nH]c5cnc(-c6cccnc6)cc5c4c3)cc2)CC1 |
| InChI | InChI=1S/C29H30N6O3S/c1-39(36,37)35-13-11-34(12-14-35)10-3-15-38-24-7-5-21(6-8-24)23-16-26-25-17-27(22-4-2-9-30-18-22)31-20-28(25)33-29(26)32-19-23/h2,4-9,16-20H,3,10-15H2,1H3,(H,32,33) |
| InChIKey | DAMKAAKDTWDYKJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|