C29H37N5O — CID 66766203
5-[6-[4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]-9H-pyrido[2,3-b]indol-3-yl]pentan-1-amine (PubChem CID 66766203) has the molecular formula C29H37N5O and a molecular weight of 471.65 g/mol. Its IUPAC name is 5-[6-[4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]-9H-pyrido[2,3-b]indol-3-yl]pentan-1-amine.
| Compound Name | 5-[6-[4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]-9H-pyrido[2,3-b]indol-3-yl]pentan-1-amine |
|---|---|
| PubChem CID | 66766203 |
| Molecular Formula | C29H37N5O |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.30 |
| IUPAC Name | 5-[6-[4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]-9H-pyrido[2,3-b]indol-3-yl]pentan-1-amine |
| SMILES | CN1CCN(CCOc2ccc(-c3ccc4[nH]c5ncc(CCCCCN)cc5c4c3)cc2)CC1 |
| InChI | InChI=1S/C29H37N5O/c1-33-13-15-34(16-14-33)17-18-35-25-9-6-23(7-10-25)24-8-11-28-26(20-24)27-19-22(5-3-2-4-12-30)21-31-29(27)32-28/h6-11,19-21H,2-5,12-18,30H2,1H3,(H,31,32) |
| InChIKey | PXOYWEFIIOACAW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 70.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|