C29H36N4O — CID 68641087
6-[4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]-3-pentyl-9H-pyrido[2,3-b]indole (PubChem CID 68641087) has the molecular formula C29H36N4O and a molecular weight of 456.63 g/mol. Its IUPAC name is 6-[4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]-3-pentyl-9H-pyrido[2,3-b]indole.
| Compound Name | 6-[4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]-3-pentyl-9H-pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 68641087 |
| Molecular Formula | C29H36N4O |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | 6-[4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]-3-pentyl-9H-pyrido[2,3-b]indole |
| SMILES | CCCCCc1cnc2[nH]c3ccc(-c4ccc(OCCN5CCN(C)CC5)cc4)cc3c2c1 |
| InChI | InChI=1S/C29H36N4O/c1-3-4-5-6-22-19-27-26-20-24(9-12-28(26)31-29(27)30-21-22)23-7-10-25(11-8-23)34-18-17-33-15-13-32(2)14-16-33/h7-12,19-21H,3-6,13-18H2,1-2H3,(H,30,31) |
| InChIKey | GVCAETQXAWYALC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|