C21H14N4O — CID 58354688
4-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)phenol (PubChem CID 58354688) has the molecular formula C21H14N4O and a molecular weight of 338.37 g/mol. Its IUPAC name is 4-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)phenol.
| Compound Name | 4-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)phenol |
|---|---|
| PubChem CID | 58354688 |
| Molecular Formula | C21H14N4O |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 4-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)phenol |
| SMILES | Oc1ccc(-c2cnc3[nH]c4cnc(-c5cccnc5)cc4c3c2)cc1 |
| InChI | InChI=1S/C21H14N4O/c26-16-5-3-13(4-6-16)15-8-18-17-9-19(14-2-1-7-22-10-14)23-12-20(17)25-21(18)24-11-15/h1-12,26H,(H,24,25) |
| InChIKey | RNRJTIWXDMOKLI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |