C17H10F3N3 — CID 53244604
3-pyridin-3-yl-6-(trifluoromethyl)-9H-pyrido[3,4-b]indole (PubChem CID 53244604) has the molecular formula C17H10F3N3 and a molecular weight of 313.28 g/mol. Its IUPAC name is 3-pyridin-3-yl-6-(trifluoromethyl)-9H-pyrido[3,4-b]indole.
| Compound Name | 3-pyridin-3-yl-6-(trifluoromethyl)-9H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 53244604 |
| Molecular Formula | C17H10F3N3 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 3-pyridin-3-yl-6-(trifluoromethyl)-9H-pyrido[3,4-b]indole |
| SMILES | FC(F)(F)c1ccc2[nH]c3cnc(-c4cccnc4)cc3c2c1 |
| InChI | InChI=1S/C17H10F3N3/c18-17(19,20)11-3-4-14-12(6-11)13-7-15(22-9-16(13)23-14)10-2-1-5-21-8-10/h1-9,23H |
| InChIKey | XENKYFDLMZUTJO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |