C50H62N5OP — CID 123719759
dicyclohexyl-[2-[4-methyl-2,6-di(propan-2-yl)phenyl]phenyl]phosphane;4-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)morpholine (PubChem CID 123719759) has the molecular formula C50H62N5OP and a molecular weight of 780.05 g/mol. Its IUPAC name is dicyclohexyl-[2-[4-methyl-2,6-di(propan-2-yl)phenyl]phenyl]phosphane;4-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)morpholine.
| Compound Name | dicyclohexyl-[2-[4-methyl-2,6-di(propan-2-yl)phenyl]phenyl]phosphane;4-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)morpholine |
|---|---|
| PubChem CID | 123719759 |
| Molecular Formula | C50H62N5OP |
| Molecular Weight | 780.05 g/mol |
| Exact Mass | 779.47 |
| IUPAC Name | dicyclohexyl-[2-[4-methyl-2,6-di(propan-2-yl)phenyl]phenyl]phosphane;4-(4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-12-yl)morpholine |
| SMILES | Cc1cc(C(C)C)c(-c2ccccc2P(C2CCCCC2)C2CCCCC2)c(C(C)C)c1.c1cncc(-c2cc3c(cn2)[nH]c2ncc(N4CCOCC4)cc23)c1 |
| InChI | InChI=1S/C31H45P.C19H17N5O/c1-22(2)28-20-24(5)21-29(23(3)4)31(28)27-18-12-13-19-30(27)32(25-14-8-6-9-15-25)26-16-10-7-11-17-26;1-2-13(10-20-3-1)17-9-15-16-8-14(24-4-6-25-7-5-24)11-22-19(16)23-18(15)12-21-17/h12-13,18-23,25-26H,6-11,14-17H2,1-5H3;1-3,8-12H,4-7H2,(H,22,23) |
| InChIKey | ZYXAKGUQDROGSC-UHFFFAOYSA-N |
| XLogP | 12.69 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.05 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|