C37H49P — CID 166514604
dicyclohexyl-[2-[4-(3-methylphenyl)-2,6-di(propan-2-yl)phenyl]phenyl]phosphane (PubChem CID 166514604) has the molecular formula C37H49P and a molecular weight of 524.77 g/mol. Its IUPAC name is dicyclohexyl-[2-[4-(3-methylphenyl)-2,6-di(propan-2-yl)phenyl]phenyl]phosphane.
| Compound Name | dicyclohexyl-[2-[4-(3-methylphenyl)-2,6-di(propan-2-yl)phenyl]phenyl]phosphane |
|---|---|
| PubChem CID | 166514604 |
| Molecular Formula | C37H49P |
| Molecular Weight | 524.77 g/mol |
| Exact Mass | 524.36 |
| IUPAC Name | dicyclohexyl-[2-[4-(3-methylphenyl)-2,6-di(propan-2-yl)phenyl]phenyl]phosphane |
| SMILES | Cc1cccc(-c2cc(C(C)C)c(-c3ccccc3P(C3CCCCC3)C3CCCCC3)c(C(C)C)c2)c1 |
| InChI | InChI=1S/C37H49P/c1-26(2)34-24-30(29-16-14-15-28(5)23-29)25-35(27(3)4)37(34)33-21-12-13-22-36(33)38(31-17-8-6-9-18-31)32-19-10-7-11-20-32/h12-16,21-27,31-32H,6-11,17-20H2,1-5H3 |
| InChIKey | ATLGZNNDQJRWER-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.77 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|