C26H35O2PPd+2 — CID 71494531
dicyclohexyl-[2-(2,6-dimethoxyphenyl)phenyl]phosphane;palladium(2+) (PubChem CID 71494531) has the molecular formula C26H35O2PPd+2 and a molecular weight of 516.96 g/mol. Its IUPAC name is dicyclohexyl-[2-(2,6-dimethoxyphenyl)phenyl]phosphane;palladium(2+).
| Compound Name | dicyclohexyl-[2-(2,6-dimethoxyphenyl)phenyl]phosphane;palladium(2+) |
|---|---|
| PubChem CID | 71494531 |
| Molecular Formula | C26H35O2PPd+2 |
| Molecular Weight | 516.96 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | dicyclohexyl-[2-(2,6-dimethoxyphenyl)phenyl]phosphane;palladium(2+) |
| SMILES | COc1cccc(OC)c1-c1ccccc1P(C1CCCCC1)C1CCCCC1.[Pd+2] |
| InChI | InChI=1S/C26H35O2P.Pd/c1-27-23-17-11-18-24(28-2)26(23)22-16-9-10-19-25(22)29(20-12-5-3-6-13-20)21-14-7-4-8-15-21;/h9-11,16-21H,3-8,12-15H2,1-2H3;/q;+2 |
| InChIKey | SUCMVABCFQLIMN-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.96 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|