C26H35O5PS — CID 11555318
3-(2-dicyclohexylphosphanylphenyl)-2,4-dimethoxybenzenesulfonic acid (PubChem CID 11555318) has the molecular formula C26H35O5PS and a molecular weight of 490.60 g/mol. Its IUPAC name is 3-(2-dicyclohexylphosphanylphenyl)-2,4-dimethoxybenzenesulfonic acid.
| Compound Name | 3-(2-dicyclohexylphosphanylphenyl)-2,4-dimethoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 11555318 |
| Molecular Formula | C26H35O5PS |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 3-(2-dicyclohexylphosphanylphenyl)-2,4-dimethoxybenzenesulfonic acid |
| SMILES | COc1ccc(S(=O)(=O)O)c(OC)c1-c1ccccc1P(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C26H35O5PS/c1-30-22-17-18-24(33(27,28)29)26(31-2)25(22)21-15-9-10-16-23(21)32(19-11-5-3-6-12-19)20-13-7-4-8-14-20/h9-10,15-20H,3-8,11-14H2,1-2H3,(H,27,28,29) |
| InChIKey | DPMQLOQXDNTHDW-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|