About dicyclohexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate
dicyclohexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate (PubChem CID 88920864) has the molecular formula C26H35O5PS
and a molecular weight of 490.60 g/mol. Its IUPAC name is dicyclohexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate.
Molecular Properties
| Compound Name | dicyclohexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate |
| PubChem CID | 88920864 |
| Molecular Formula | C26H35O5PS |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | dicyclohexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)OP(C2CCCCC2)C2CCCCC2)c(OC)c1-c1ccccc1 |
| InChI | InChI=1S/C26H35O5PS/c1-29-23-18-19-24(26(30-2)25(23)20-12-6-3-7-13-20)33(27,28)31-32(21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3,6-7,12-13,18-19,21-22H,4-5,8-11,14-17H2,1-2H3 |
| InChIKey | UVDPPHIRXGLADX-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dicyclohexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclohexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate?
The IUPAC name of dicyclohexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate (CID 88920864) is dicyclohexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate.
What is the SMILES notation for dicyclohexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate?
The canonical SMILES for dicyclohexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate is COc1ccc(S(=O)(=O)OP(C2CCCCC2)C2CCCCC2)c(OC)c1-c1ccccc1.
What is the InChIKey of dicyclohexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate?
The InChIKey is UVDPPHIRXGLADX-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H35O5PS/c1-29-23-18-19-24(26(30-2)25(23)20-12-6-3-7-13-20)33(27,28)31-32(21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3,6-7,12-13,18-19,21-22H,4-5,8-11,14-17H2,1-2H3.
What are the key properties of dicyclohexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate?
dicyclohexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate has a molecular weight of 490.60 g/mol, XLogP of 7.14, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclohexylphosphanyl 2,4-dimethoxy-3-phenylbenzenesulfonate is sourced from PubChem (CID 88920864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).