C20H27O2P — CID 67542071
(2,4-dimethoxy-3-phenylphenyl)-hexylphosphane (PubChem CID 67542071) has the molecular formula C20H27O2P and a molecular weight of 330.41 g/mol. Its IUPAC name is (2,4-dimethoxy-3-phenylphenyl)-hexylphosphane.
| Compound Name | (2,4-dimethoxy-3-phenylphenyl)-hexylphosphane |
|---|---|
| PubChem CID | 67542071 |
| Molecular Formula | C20H27O2P |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (2,4-dimethoxy-3-phenylphenyl)-hexylphosphane |
| SMILES | CCCCCCPc1ccc(OC)c(-c2ccccc2)c1OC |
| InChI | InChI=1S/C20H27O2P/c1-4-5-6-10-15-23-18-14-13-17(21-2)19(20(18)22-3)16-11-8-7-9-12-16/h7-9,11-14,23H,4-6,10,15H2,1-3H3 |
| InChIKey | VQUBXUVZDFMTQX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|