C14H15O5P — CID 174858639
(2,4-dimethoxy-3-phenylphenyl)phosphonic acid (PubChem CID 174858639) has the molecular formula C14H15O5P and a molecular weight of 294.24 g/mol. Its IUPAC name is (2,4-dimethoxy-3-phenylphenyl)phosphonic acid.
| Compound Name | (2,4-dimethoxy-3-phenylphenyl)phosphonic acid |
|---|---|
| PubChem CID | 174858639 |
| Molecular Formula | C14H15O5P |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | (2,4-dimethoxy-3-phenylphenyl)phosphonic acid |
| SMILES | COc1ccc(P(=O)(O)O)c(OC)c1-c1ccccc1 |
| InChI | InChI=1S/C14H15O5P/c1-18-11-8-9-12(20(15,16)17)14(19-2)13(11)10-6-4-3-5-7-10/h3-9H,1-2H3,(H2,15,16,17) |
| InChIKey | ICQVSCZIRNIIOX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|