C16H21O6P — CID 160922447
4-methoxy-2,3,5-trimethyl-6-phenylphenol;phosphoric acid (PubChem CID 160922447) has the molecular formula C16H21O6P and a molecular weight of 340.31 g/mol. Its IUPAC name is 4-methoxy-2,3,5-trimethyl-6-phenylphenol;phosphoric acid.
| Compound Name | 4-methoxy-2,3,5-trimethyl-6-phenylphenol;phosphoric acid |
|---|---|
| PubChem CID | 160922447 |
| Molecular Formula | C16H21O6P |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 4-methoxy-2,3,5-trimethyl-6-phenylphenol;phosphoric acid |
| SMILES | COc1c(C)c(C)c(O)c(-c2ccccc2)c1C.O=P(O)(O)O |
| InChI | InChI=1S/C16H18O2.H3O4P/c1-10-11(2)16(18-4)12(3)14(15(10)17)13-8-6-5-7-9-13;1-5(2,3)4/h5-9,17H,1-4H3;(H3,1,2,3,4) |
| InChIKey | QOFHCRNSUGLJOD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|