C54H48O2P2 — CID 58152974
[2-(2-diphenylphosphanyl-4-methoxy-5,6-dimethyl-3-phenylphenyl)-5-methoxy-3,4-dimethyl-6-phenylphenyl]-diphenylphosphane (PubChem CID 58152974) has the molecular formula C54H48O2P2 and a molecular weight of 790.92 g/mol. Its IUPAC name is [2-(2-diphenylphosphanyl-4-methoxy-5,6-dimethyl-3-phenylphenyl)-5-methoxy-3,4-dimethyl-6-phenylphenyl]-diphenylphosphane.
| Compound Name | [2-(2-diphenylphosphanyl-4-methoxy-5,6-dimethyl-3-phenylphenyl)-5-methoxy-3,4-dimethyl-6-phenylphenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 58152974 |
| Molecular Formula | C54H48O2P2 |
| Molecular Weight | 790.92 g/mol |
| Exact Mass | 790.31 |
| IUPAC Name | [2-(2-diphenylphosphanyl-4-methoxy-5,6-dimethyl-3-phenylphenyl)-5-methoxy-3,4-dimethyl-6-phenylphenyl]-diphenylphosphane |
| SMILES | COc1c(C)c(C)c(-c2c(C)c(C)c(OC)c(-c3ccccc3)c2P(c2ccccc2)c2ccccc2)c(P(c2ccccc2)c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C54H48O2P2/c1-37-39(3)51(55-5)49(41-25-13-7-14-26-41)53(57(43-29-17-9-18-30-43)44-31-19-10-20-32-44)47(37)48-38(2)40(4)52(56-6)50(42-27-15-8-16-28-42)54(48)58(45-33-21-11-22-34-45)46-35-23-12-24-36-46/h7-36H,1-6H3 |
| InChIKey | XUQAVIHCSCJFOI-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.92 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|