C27H50 — CID 91414507
ethane;1,2,3,4,5-pentamethyl-6-phenylbenzene (PubChem CID 91414507) has the molecular formula C27H50 and a molecular weight of 374.70 g/mol. Its IUPAC name is ethane;1,2,3,4,5-pentamethyl-6-phenylbenzene.
| Compound Name | ethane;1,2,3,4,5-pentamethyl-6-phenylbenzene |
|---|---|
| PubChem CID | 91414507 |
| Molecular Formula | C27H50 |
| Molecular Weight | 374.70 g/mol |
| Exact Mass | 374.39 |
| IUPAC Name | ethane;1,2,3,4,5-pentamethyl-6-phenylbenzene |
| SMILES | CC.CC.CC.CC.CC.Cc1c(C)c(C)c(-c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C17H20.5C2H6/c1-11-12(2)14(4)17(15(5)13(11)3)16-9-7-6-8-10-16;5*1-2/h6-10H,1-5H3;5*1-2H3 |
| InChIKey | RGXNYEIAWCMXKE-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.70 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |