C25H22N+ — CID 100929279
3,5-dimethyl-2,4,6-triphenylpyridin-1-ium (PubChem CID 100929279) has the molecular formula C25H22N+ and a molecular weight of 336.46 g/mol. Its IUPAC name is 3,5-dimethyl-2,4,6-triphenylpyridin-1-ium.
| Compound Name | 3,5-dimethyl-2,4,6-triphenylpyridin-1-ium |
|---|---|
| PubChem CID | 100929279 |
| Molecular Formula | C25H22N+ |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 3,5-dimethyl-2,4,6-triphenylpyridin-1-ium |
| SMILES | Cc1c(-c2ccccc2)[nH+]c(-c2ccccc2)c(C)c1-c1ccccc1 |
| InChI | InChI=1S/C25H21N/c1-18-23(20-12-6-3-7-13-20)19(2)25(22-16-10-5-11-17-22)26-24(18)21-14-8-4-9-15-21/h3-17H,1-2H3/p+1 |
| InChIKey | KISDFRAQJWGNCO-UHFFFAOYSA-O |
| XLogP | 6.12 |
| TPSA | 14.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |