C39H36 — CID 59002262
1,2,3,4,5,6,8-heptamethyl-7,9,10-triphenylanthracene (PubChem CID 59002262) has the molecular formula C39H36 and a molecular weight of 504.72 g/mol. Its IUPAC name is 1,2,3,4,5,6,8-heptamethyl-7,9,10-triphenylanthracene.
| Compound Name | 1,2,3,4,5,6,8-heptamethyl-7,9,10-triphenylanthracene |
|---|---|
| PubChem CID | 59002262 |
| Molecular Formula | C39H36 |
| Molecular Weight | 504.72 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | 1,2,3,4,5,6,8-heptamethyl-7,9,10-triphenylanthracene |
| SMILES | Cc1c(C)c(C)c2c(-c3ccccc3)c3c(C)c(-c4ccccc4)c(C)c(C)c3c(-c3ccccc3)c2c1C |
| InChI | InChI=1S/C39H36/c1-23-24(2)26(4)35-34(25(23)3)38(31-19-13-9-14-20-31)36-28(6)27(5)33(30-17-11-8-12-18-30)29(7)37(36)39(35)32-21-15-10-16-22-32/h8-22H,1-7H3 |
| InChIKey | OZUOIOFDVCUNKB-UHFFFAOYSA-N |
| XLogP | 11.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.72 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|