C53H54O — CID 167347084
1,2,3,4,6,7,9-heptamethyl-8-[1,2,3,4,5,6,7,8-octamethyl-10-(2-phenylphenyl)anthracen-9-yl]dibenzofuran (PubChem CID 167347084) has the molecular formula C53H54O and a molecular weight of 707.01 g/mol. Its IUPAC name is 1,2,3,4,6,7,9-heptamethyl-8-[1,2,3,4,5,6,7,8-octamethyl-10-(2-phenylphenyl)anthracen-9-yl]dibenzofuran.
| Compound Name | 1,2,3,4,6,7,9-heptamethyl-8-[1,2,3,4,5,6,7,8-octamethyl-10-(2-phenylphenyl)anthracen-9-yl]dibenzofuran |
|---|---|
| PubChem CID | 167347084 |
| Molecular Formula | C53H54O |
| Molecular Weight | 707.01 g/mol |
| Exact Mass | 706.42 |
| IUPAC Name | 1,2,3,4,6,7,9-heptamethyl-8-[1,2,3,4,5,6,7,8-octamethyl-10-(2-phenylphenyl)anthracen-9-yl]dibenzofuran |
| SMILES | Cc1c(C)c(C)c2c(oc3c(C)c(C)c(-c4c5c(C)c(C)c(C)c(C)c5c(-c5ccccc5-c5ccccc5)c5c(C)c(C)c(C)c(C)c45)c(C)c32)c1C |
| InChI | InChI=1S/C53H54O/c1-25-27(3)33(9)46-44(31(25)7)50(42-24-20-19-23-41(42)40-21-17-16-18-22-40)45-32(8)26(2)28(4)34(10)47(45)51(46)43-36(12)38(14)53-49(39(43)15)48-35(11)29(5)30(6)37(13)52(48)54-53/h16-24H,1-15H3 |
| InChIKey | XPVNZBXEZQJRQR-UHFFFAOYSA-N |
| XLogP | 15.52 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.01 |
| LogP ≤ 5 | 15.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|