C55H54O — CID 167347261
1,2,3,4,6,7,8-heptamethyl-9-(1,2,3,4,5,6,7,8-octamethyl-10-phenanthren-2-ylanthracen-9-yl)dibenzofuran (PubChem CID 167347261) has the molecular formula C55H54O and a molecular weight of 731.04 g/mol. Its IUPAC name is 1,2,3,4,6,7,8-heptamethyl-9-(1,2,3,4,5,6,7,8-octamethyl-10-phenanthren-2-ylanthracen-9-yl)dibenzofuran.
| Compound Name | 1,2,3,4,6,7,8-heptamethyl-9-(1,2,3,4,5,6,7,8-octamethyl-10-phenanthren-2-ylanthracen-9-yl)dibenzofuran |
|---|---|
| PubChem CID | 167347261 |
| Molecular Formula | C55H54O |
| Molecular Weight | 731.04 g/mol |
| Exact Mass | 730.42 |
| IUPAC Name | 1,2,3,4,6,7,8-heptamethyl-9-(1,2,3,4,5,6,7,8-octamethyl-10-phenanthren-2-ylanthracen-9-yl)dibenzofuran |
| SMILES | Cc1c(C)c(C)c2c(oc3c(C)c(C)c(C)c(-c4c5c(C)c(C)c(C)c(C)c5c(-c5ccc6c(ccc7ccccc76)c5)c5c(C)c(C)c(C)c(C)c45)c32)c1C |
| InChI | InChI=1S/C55H54O/c1-25-27(3)34(10)47-45(32(25)8)51(42-22-23-44-41(24-42)21-20-40-18-16-17-19-43(40)44)46-33(9)26(2)28(4)35(11)48(46)52(47)49-36(12)31(7)39(15)55-53(49)50-37(13)29(5)30(6)38(14)54(50)56-55/h16-24H,1-15H3 |
| InChIKey | NCKOGTRGDUUWCK-UHFFFAOYSA-N |
| XLogP | 16.16 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.04 |
| LogP ≤ 5 | 16.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|