C39H37N — CID 163458422
4,5,6,9,10,11,14,15,16-nonamethyl-3,17-diphenyl-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8(19),9,11,13(18),14,16-nonaene (PubChem CID 163458422) has the molecular formula C39H37N and a molecular weight of 519.73 g/mol. Its IUPAC name is 4,5,6,9,10,11,14,15,16-nonamethyl-3,17-diphenyl-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8(19),9,11,13(18),14,16-nonaene.
| Compound Name | 4,5,6,9,10,11,14,15,16-nonamethyl-3,17-diphenyl-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8(19),9,11,13(18),14,16-nonaene |
|---|---|
| PubChem CID | 163458422 |
| Molecular Formula | C39H37N |
| Molecular Weight | 519.73 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | 4,5,6,9,10,11,14,15,16-nonamethyl-3,17-diphenyl-1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2(7),3,5,8(19),9,11,13(18),14,16-nonaene |
| SMILES | Cc1c(C)c(-c2ccccc2)c2c(c1C)c1c(C)c(C)c(C)c3c4c(C)c(C)c(C)c(-c5ccccc5)c4n2c13 |
| InChI | InChI=1S/C39H37N/c1-20-23(4)31(29-16-12-10-13-17-29)37-33(25(20)6)35-27(8)22(3)28(9)36-34-26(7)21(2)24(5)32(30-18-14-11-15-19-30)38(34)40(37)39(35)36/h10-19H,1-9H3 |
| InChIKey | WOKVKWDGNOWCGL-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.73 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |