C36H29N — CID 166512378
2,5-bis(4-methylphenyl)-1,3,4-triphenylpyrrole (PubChem CID 166512378) has the molecular formula C36H29N and a molecular weight of 475.64 g/mol. Its IUPAC name is 2,5-bis(4-methylphenyl)-1,3,4-triphenylpyrrole.
| Compound Name | 2,5-bis(4-methylphenyl)-1,3,4-triphenylpyrrole |
|---|---|
| PubChem CID | 166512378 |
| Molecular Formula | C36H29N |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 2,5-bis(4-methylphenyl)-1,3,4-triphenylpyrrole |
| SMILES | Cc1ccc(-c2c(-c3ccccc3)c(-c3ccccc3)c(-c3ccc(C)cc3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C36H29N/c1-26-18-22-30(23-19-26)35-33(28-12-6-3-7-13-28)34(29-14-8-4-9-15-29)36(31-24-20-27(2)21-25-31)37(35)32-16-10-5-11-17-32/h3-25H,1-2H3 |
| InChIKey | BOMVRQUDRQPKOT-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |