C42H35NSi — CID 159315059
[4-methyl-5-(4-methylphenyl)-1,2-diphenylpyrrol-3-yl]-triphenylsilane (PubChem CID 159315059) has the molecular formula C42H35NSi and a molecular weight of 581.84 g/mol. Its IUPAC name is [4-methyl-5-(4-methylphenyl)-1,2-diphenylpyrrol-3-yl]-triphenylsilane.
| Compound Name | [4-methyl-5-(4-methylphenyl)-1,2-diphenylpyrrol-3-yl]-triphenylsilane |
|---|---|
| PubChem CID | 159315059 |
| Molecular Formula | C42H35NSi |
| Molecular Weight | 581.84 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | [4-methyl-5-(4-methylphenyl)-1,2-diphenylpyrrol-3-yl]-triphenylsilane |
| SMILES | Cc1ccc(-c2c(C)c([Si](c3ccccc3)(c3ccccc3)c3ccccc3)c(-c3ccccc3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C42H35NSi/c1-32-28-30-35(31-29-32)40-33(2)42(41(34-18-8-3-9-19-34)43(40)36-20-10-4-11-21-36)44(37-22-12-5-13-23-37,38-24-14-6-15-25-38)39-26-16-7-17-27-39/h3-31H,1-2H3 |
| InChIKey | QKQJBDAMLOVWIH-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.84 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|