About 2-(4-methylphenyl)-1,3,4-triphenyl-5-[4-[(E)-prop-1-enyl]phenyl]pyrrole
2-(4-methylphenyl)-1,3,4-triphenyl-5-[4-[(E)-prop-1-enyl]phenyl]pyrrole (PubChem CID 166512404) has the molecular formula C38H31N
and a molecular weight of 501.67 g/mol. Its IUPAC name is 2-(4-methylphenyl)-1,3,4-triphenyl-5-[4-[(E)-prop-1-enyl]phenyl]pyrrole.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)-1,3,4-triphenyl-5-[4-[(E)-prop-1-enyl]phenyl]pyrrole |
| PubChem CID | 166512404 |
| Molecular Formula | C38H31N |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | 2-(4-methylphenyl)-1,3,4-triphenyl-5-[4-[(E)-prop-1-enyl]phenyl]pyrrole |
| SMILES | C/C=C/c1ccc(-c2c(-c3ccccc3)c(-c3ccccc3)c(-c3ccc(C)cc3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C38H31N/c1-3-13-29-22-26-33(27-23-29)38-36(31-16-9-5-10-17-31)35(30-14-7-4-8-15-30)37(32-24-20-28(2)21-25-32)39(38)34-18-11-6-12-19-34/h3-27H,1-2H3/b13-3+ |
| InChIKey | IFEZUAGRKZTXGO-QLKAYGNNSA-N |
| XLogP | 10.49 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-methylphenyl)-1,3,4-triphenyl-5-[4-[(E)-prop-1-enyl]phenyl]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)-1,3,4-triphenyl-5-[4-[(E)-prop-1-enyl]phenyl]pyrrole?
The IUPAC name of 2-(4-methylphenyl)-1,3,4-triphenyl-5-[4-[(E)-prop-1-enyl]phenyl]pyrrole (CID 166512404) is 2-(4-methylphenyl)-1,3,4-triphenyl-5-[4-[(E)-prop-1-enyl]phenyl]pyrrole.
What is the SMILES notation for 2-(4-methylphenyl)-1,3,4-triphenyl-5-[4-[(E)-prop-1-enyl]phenyl]pyrrole?
The canonical SMILES for 2-(4-methylphenyl)-1,3,4-triphenyl-5-[4-[(E)-prop-1-enyl]phenyl]pyrrole is C/C=C/c1ccc(-c2c(-c3ccccc3)c(-c3ccccc3)c(-c3ccc(C)cc3)n2-c2ccccc2)cc1.
What is the InChIKey of 2-(4-methylphenyl)-1,3,4-triphenyl-5-[4-[(E)-prop-1-enyl]phenyl]pyrrole?
The InChIKey is IFEZUAGRKZTXGO-QLKAYGNNSA-N. The full InChI is InChI=1S/C38H31N/c1-3-13-29-22-26-33(27-23-29)38-36(31-16-9-5-10-17-31)35(30-14-7-4-8-15-30)37(32-24-20-28(2)21-25-32)39(38)34-18-11-6-12-19-34/h3-27H,1-2H3/b13-3+.
What are the key properties of 2-(4-methylphenyl)-1,3,4-triphenyl-5-[4-[(E)-prop-1-enyl]phenyl]pyrrole?
2-(4-methylphenyl)-1,3,4-triphenyl-5-[4-[(E)-prop-1-enyl]phenyl]pyrrole has a molecular weight of 501.67 g/mol, XLogP of 10.49, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)-1,3,4-triphenyl-5-[4-[(E)-prop-1-enyl]phenyl]pyrrole is sourced from PubChem (CID 166512404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).