C38H31N — CID 166512404
2-(4-methylphenyl)-1,3,4-triphenyl-5-[4-[(E)-prop-1-enyl]phenyl]pyrrole (PubChem CID 166512404) has the molecular formula C38H31N and a molecular weight of 501.67 g/mol. Its IUPAC name is 2-(4-methylphenyl)-1,3,4-triphenyl-5-[4-[(E)-prop-1-enyl]phenyl]pyrrole.
| Compound Name | 2-(4-methylphenyl)-1,3,4-triphenyl-5-[4-[(E)-prop-1-enyl]phenyl]pyrrole |
|---|---|
| PubChem CID | 166512404 |
| Molecular Formula | C38H31N |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | 2-(4-methylphenyl)-1,3,4-triphenyl-5-[4-[(E)-prop-1-enyl]phenyl]pyrrole |
| SMILES | C/C=C/c1ccc(-c2c(-c3ccccc3)c(-c3ccccc3)c(-c3ccc(C)cc3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C38H31N/c1-3-13-29-22-26-33(27-23-29)38-36(31-16-9-5-10-17-31)35(30-14-7-4-8-15-30)37(32-24-20-28(2)21-25-32)39(38)34-18-11-6-12-19-34/h3-27H,1-2H3/b13-3+ |
| InChIKey | IFEZUAGRKZTXGO-QLKAYGNNSA-N |
| XLogP | 10.49 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |