C36H35N — CID 160992457
1,2-bis(4-methylphenyl)-5-[4-[(E)-2-phenylethenyl]phenyl]pyrrole;(E)-but-2-ene (PubChem CID 160992457) has the molecular formula C36H35N and a molecular weight of 481.68 g/mol. Its IUPAC name is 1,2-bis(4-methylphenyl)-5-[4-[(E)-2-phenylethenyl]phenyl]pyrrole;(E)-but-2-ene.
| Compound Name | 1,2-bis(4-methylphenyl)-5-[4-[(E)-2-phenylethenyl]phenyl]pyrrole;(E)-but-2-ene |
|---|---|
| PubChem CID | 160992457 |
| Molecular Formula | C36H35N |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | 1,2-bis(4-methylphenyl)-5-[4-[(E)-2-phenylethenyl]phenyl]pyrrole;(E)-but-2-ene |
| SMILES | C/C=C/C.Cc1ccc(-c2ccc(-c3ccc(/C=C/c4ccccc4)cc3)n2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C32H27N.C4H8/c1-24-8-16-28(17-9-24)31-22-23-32(33(31)30-20-10-25(2)11-21-30)29-18-14-27(15-19-29)13-12-26-6-4-3-5-7-26;1-3-4-2/h3-23H,1-2H3;3-4H,1-2H3/b13-12+;4-3+ |
| InChIKey | TUUVTXUOOXWOMZ-WIYRWWQASA-N |
| XLogP | 10.18 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|