C56H44N2 — CID 140923989
9-[4-[(E)-2-[4-[4-[(E)-2-[4-(3,6-dimethylcarbazol-9-yl)phenyl]ethenyl]phenyl]phenyl]ethenyl]phenyl]-3,6-dimethylcarbazole (PubChem CID 140923989) has the molecular formula C56H44N2 and a molecular weight of 744.98 g/mol. Its IUPAC name is 9-[4-[(E)-2-[4-[4-[(E)-2-[4-(3,6-dimethylcarbazol-9-yl)phenyl]ethenyl]phenyl]phenyl]ethenyl]phenyl]-3,6-dimethylcarbazole.
| Compound Name | 9-[4-[(E)-2-[4-[4-[(E)-2-[4-(3,6-dimethylcarbazol-9-yl)phenyl]ethenyl]phenyl]phenyl]ethenyl]phenyl]-3,6-dimethylcarbazole |
|---|---|
| PubChem CID | 140923989 |
| Molecular Formula | C56H44N2 |
| Molecular Weight | 744.98 g/mol |
| Exact Mass | 744.35 |
| IUPAC Name | 9-[4-[(E)-2-[4-[4-[(E)-2-[4-(3,6-dimethylcarbazol-9-yl)phenyl]ethenyl]phenyl]phenyl]ethenyl]phenyl]-3,6-dimethylcarbazole |
| SMILES | Cc1ccc2c(c1)c1cc(C)ccc1n2-c1ccc(/C=C/c2ccc(-c3ccc(/C=C/c4ccc(-n5c6ccc(C)cc6c6cc(C)ccc65)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C56H44N2/c1-37-5-29-53-49(33-37)50-34-38(2)6-30-54(50)57(53)47-25-17-43(18-26-47)11-9-41-13-21-45(22-14-41)46-23-15-42(16-24-46)10-12-44-19-27-48(28-20-44)58-55-31-7-39(3)35-51(55)52-36-40(4)8-32-56(52)58/h5-36H,1-4H3/b11-9+,12-10+ |
| InChIKey | RGGDCWXKTMVWIJ-WGDLNXRISA-N |
| XLogP | 15.12 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.98 |
| LogP ≤ 5 | 15.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|