C41H35N — CID 72640522
1-(4-methylphenyl)-2,5-bis[4-[2-(4-methylphenyl)ethenyl]phenyl]pyrrole (PubChem CID 72640522) has the molecular formula C41H35N and a molecular weight of 541.74 g/mol. Its IUPAC name is 1-(4-methylphenyl)-2,5-bis[4-[2-(4-methylphenyl)ethenyl]phenyl]pyrrole.
| Compound Name | 1-(4-methylphenyl)-2,5-bis[4-[2-(4-methylphenyl)ethenyl]phenyl]pyrrole |
|---|---|
| PubChem CID | 72640522 |
| Molecular Formula | C41H35N |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | 1-(4-methylphenyl)-2,5-bis[4-[2-(4-methylphenyl)ethenyl]phenyl]pyrrole |
| SMILES | Cc1ccc(C=Cc2ccc(-c3ccc(-c4ccc(C=Cc5ccc(C)cc5)cc4)n3-c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C41H35N/c1-30-4-10-33(11-5-30)14-16-35-18-22-37(23-19-35)40-28-29-41(42(40)39-26-8-32(3)9-27-39)38-24-20-36(21-25-38)17-15-34-12-6-31(2)7-13-34/h4-29H,1-3H3 |
| InChIKey | AOOUOYPVJBINNE-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|