C32H27N — CID 143904791
3-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-9-(4-methylphenyl)-6-phenylcarbazole (PubChem CID 143904791) has the molecular formula C32H27N and a molecular weight of 425.58 g/mol. Its IUPAC name is 3-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-9-(4-methylphenyl)-6-phenylcarbazole.
| Compound Name | 3-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-9-(4-methylphenyl)-6-phenylcarbazole |
|---|---|
| PubChem CID | 143904791 |
| Molecular Formula | C32H27N |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 3-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-9-(4-methylphenyl)-6-phenylcarbazole |
| SMILES | C/C=C\C=C/C=C/c1ccc2c(c1)c1cc(-c3ccccc3)ccc1n2-c1ccc(C)cc1 |
| InChI | InChI=1S/C32H27N/c1-3-4-5-6-8-11-25-16-20-31-29(22-25)30-23-27(26-12-9-7-10-13-26)17-21-32(30)33(31)28-18-14-24(2)15-19-28/h3-23H,1-2H3/b4-3-,6-5-,11-8+ |
| InChIKey | JAUMUXCCKVSXRV-MRTAMQALSA-N |
| XLogP | 8.90 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|