C45H30N2O2 — CID 131743759
11-[3-[(1E,3E,5Z)-hepta-1,3,5-trienyl]-6-phenylcarbazol-9-yl]-1-azapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9,11,13(21),14,16,18-nonaene-2,20-dione (PubChem CID 131743759) has the molecular formula C45H30N2O2 and a molecular weight of 630.75 g/mol. Its IUPAC name is 11-[3-[(1E,3E,5Z)-hepta-1,3,5-trienyl]-6-phenylcarbazol-9-yl]-1-azapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9,11,13(21),14,16,18-nonaene-2,20-dione.
| Compound Name | 11-[3-[(1E,3E,5Z)-hepta-1,3,5-trienyl]-6-phenylcarbazol-9-yl]-1-azapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9,11,13(21),14,16,18-nonaene-2,20-dione |
|---|---|
| PubChem CID | 131743759 |
| Molecular Formula | C45H30N2O2 |
| Molecular Weight | 630.75 g/mol |
| Exact Mass | 630.23 |
| IUPAC Name | 11-[3-[(1E,3E,5Z)-hepta-1,3,5-trienyl]-6-phenylcarbazol-9-yl]-1-azapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9,11,13(21),14,16,18-nonaene-2,20-dione |
| SMILES | C/C=C\C=C\C=C\c1ccc2c(c1)c1cc(-c3ccccc3)ccc1n2-c1cc2c3ccccc3c(=O)n3c(=O)c4ccccc4c(c1)c23 |
| InChI | InChI=1S/C45H30N2O2/c1-2-3-4-5-7-14-29-21-23-41-37(25-29)38-26-31(30-15-8-6-9-16-30)22-24-42(38)46(41)32-27-39-33-17-10-12-19-35(33)44(48)47-43(39)40(28-32)34-18-11-13-20-36(34)45(47)49/h2-28H,1H3/b3-2-,5-4+,14-7+ |
| InChIKey | WTZDQFTVHOQQNM-JFBZHLFBSA-N |
| XLogP | 10.47 |
| TPSA | 43.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.75 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|