C32H23NO — CID 118376481
10-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5-phenyl-1-azapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2(7),3,5,8,10,12(20),13,15,17-nonaen-19-one (PubChem CID 118376481) has the molecular formula C32H23NO and a molecular weight of 437.54 g/mol. Its IUPAC name is 10-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5-phenyl-1-azapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2(7),3,5,8,10,12(20),13,15,17-nonaen-19-one.
| Compound Name | 10-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5-phenyl-1-azapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2(7),3,5,8,10,12(20),13,15,17-nonaen-19-one |
|---|---|
| PubChem CID | 118376481 |
| Molecular Formula | C32H23NO |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 10-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5-phenyl-1-azapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2(7),3,5,8,10,12(20),13,15,17-nonaen-19-one |
| SMILES | C=C(/C=C\C=C/C)c1cc2c3ccccc3c(=O)n3c4ccc(-c5ccccc5)cc4c(c1)c23 |
| InChI | InChI=1S/C32H23NO/c1-3-4-6-11-21(2)24-19-28-25-14-9-10-15-26(25)32(34)33-30-17-16-23(22-12-7-5-8-13-22)18-27(30)29(20-24)31(28)33/h3-20H,2H2,1H3/b4-3-,11-6- |
| InChIKey | LGBDDMSRVGSUND-ZRTVSTLASA-N |
| XLogP | 8.01 |
| TPSA | 21.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|