C30H24N2 — CID 129022099
(1Z,3Z)-5-[4-(9-phenylcarbazol-3-yl)phenyl]hexa-1,3,5-trien-1-amine (PubChem CID 129022099) has the molecular formula C30H24N2 and a molecular weight of 412.54 g/mol. Its IUPAC name is (1Z,3Z)-5-[4-(9-phenylcarbazol-3-yl)phenyl]hexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z)-5-[4-(9-phenylcarbazol-3-yl)phenyl]hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 129022099 |
| Molecular Formula | C30H24N2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (1Z,3Z)-5-[4-(9-phenylcarbazol-3-yl)phenyl]hexa-1,3,5-trien-1-amine |
| SMILES | C=C(/C=C\C=C/N)c1ccc(-c2ccc3c(c2)c2ccccc2n3-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H24N2/c1-22(9-7-8-20-31)23-14-16-24(17-15-23)25-18-19-30-28(21-25)27-12-5-6-13-29(27)32(30)26-10-3-2-4-11-26/h2-21H,1,31H2/b9-7-,20-8- |
| InChIKey | LWGNPMGEJOYAHN-QBUQJMDQSA-N |
| XLogP | 7.49 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|