C29H24N2S — CID 12674926
1,3-bis(4-methylphenyl)-4,5-diphenylimidazole-2-thione (PubChem CID 12674926) has the molecular formula C29H24N2S and a molecular weight of 432.59 g/mol. Its IUPAC name is 1,3-bis(4-methylphenyl)-4,5-diphenylimidazole-2-thione.
| Compound Name | 1,3-bis(4-methylphenyl)-4,5-diphenylimidazole-2-thione |
|---|---|
| PubChem CID | 12674926 |
| Molecular Formula | C29H24N2S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 1,3-bis(4-methylphenyl)-4,5-diphenylimidazole-2-thione |
| SMILES | Cc1ccc(-n2c(-c3ccccc3)c(-c3ccccc3)n(-c3ccc(C)cc3)c2=S)cc1 |
| InChI | InChI=1S/C29H24N2S/c1-21-13-17-25(18-14-21)30-27(23-9-5-3-6-10-23)28(24-11-7-4-8-12-24)31(29(30)32)26-19-15-22(2)16-20-26/h3-20H,1-2H3 |
| InChIKey | NUZDVAXDJIWDAW-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|