C30H25NO — CID 12995302
2-(4-methoxyphenyl)-1-(4-methylphenyl)-3,5-diphenylpyrrole (PubChem CID 12995302) has the molecular formula C30H25NO and a molecular weight of 415.54 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-1-(4-methylphenyl)-3,5-diphenylpyrrole.
| Compound Name | 2-(4-methoxyphenyl)-1-(4-methylphenyl)-3,5-diphenylpyrrole |
|---|---|
| PubChem CID | 12995302 |
| Molecular Formula | C30H25NO |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 2-(4-methoxyphenyl)-1-(4-methylphenyl)-3,5-diphenylpyrrole |
| SMILES | COc1ccc(-c2c(-c3ccccc3)cc(-c3ccccc3)n2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H25NO/c1-22-13-17-26(18-14-22)31-29(24-11-7-4-8-12-24)21-28(23-9-5-3-6-10-23)30(31)25-15-19-27(32-2)20-16-25/h3-21H,1-2H3 |
| InChIKey | LNKHVHLSJCBPEP-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |