C29H20F3N — CID 134948015
1,3,5-triphenyl-2-[4-(trifluoromethyl)phenyl]pyrrole (PubChem CID 134948015) has the molecular formula C29H20F3N and a molecular weight of 439.48 g/mol. Its IUPAC name is 1,3,5-triphenyl-2-[4-(trifluoromethyl)phenyl]pyrrole.
| Compound Name | 1,3,5-triphenyl-2-[4-(trifluoromethyl)phenyl]pyrrole |
|---|---|
| PubChem CID | 134948015 |
| Molecular Formula | C29H20F3N |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 1,3,5-triphenyl-2-[4-(trifluoromethyl)phenyl]pyrrole |
| SMILES | FC(F)(F)c1ccc(-c2c(-c3ccccc3)cc(-c3ccccc3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H20F3N/c30-29(31,32)24-18-16-23(17-19-24)28-26(21-10-4-1-5-11-21)20-27(22-12-6-2-7-13-22)33(28)25-14-8-3-9-15-25/h1-20H |
| InChIKey | LGJUMHRAOUSUNW-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |