C23H14FNO — CID 132542586
6-fluoro-2,3-diphenylindeno[2,1-b]pyrrol-4-one (PubChem CID 132542586) has the molecular formula C23H14FNO and a molecular weight of 339.37 g/mol. Its IUPAC name is 6-fluoro-2,3-diphenylindeno[2,1-b]pyrrol-4-one.
| Compound Name | 6-fluoro-2,3-diphenylindeno[2,1-b]pyrrol-4-one |
|---|---|
| PubChem CID | 132542586 |
| Molecular Formula | C23H14FNO |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 6-fluoro-2,3-diphenylindeno[2,1-b]pyrrol-4-one |
| SMILES | O=C1c2cc(F)ccc2-c2cc(-c3ccccc3)n(-c3ccccc3)c21 |
| InChI | InChI=1S/C23H14FNO/c24-16-11-12-18-19-14-21(15-7-3-1-4-8-15)25(17-9-5-2-6-10-17)22(19)23(26)20(18)13-16/h1-14H |
| InChIKey | NXLMPRLECNALAB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |