C24H18ClNO — CID 14303714
2-(2-chlorophenyl)-3-methyl-1,6-diphenylpyridin-4-one (PubChem CID 14303714) has the molecular formula C24H18ClNO and a molecular weight of 371.87 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-3-methyl-1,6-diphenylpyridin-4-one.
| Compound Name | 2-(2-chlorophenyl)-3-methyl-1,6-diphenylpyridin-4-one |
|---|---|
| PubChem CID | 14303714 |
| Molecular Formula | C24H18ClNO |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 2-(2-chlorophenyl)-3-methyl-1,6-diphenylpyridin-4-one |
| SMILES | Cc1c(-c2ccccc2Cl)n(-c2ccccc2)c(-c2ccccc2)cc1=O |
| InChI | InChI=1S/C24H18ClNO/c1-17-23(27)16-22(18-10-4-2-5-11-18)26(19-12-6-3-7-13-19)24(17)20-14-8-9-15-21(20)25/h2-16H,1H3 |
| InChIKey | PGCFCMUGKGADHX-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |