C27H25NO2 — CID 14303736
3-methyl-1,6-diphenyl-2-(3-propan-2-yloxyphenyl)pyridin-4-one (PubChem CID 14303736) has the molecular formula C27H25NO2 and a molecular weight of 395.50 g/mol. Its IUPAC name is 3-methyl-1,6-diphenyl-2-(3-propan-2-yloxyphenyl)pyridin-4-one.
| Compound Name | 3-methyl-1,6-diphenyl-2-(3-propan-2-yloxyphenyl)pyridin-4-one |
|---|---|
| PubChem CID | 14303736 |
| Molecular Formula | C27H25NO2 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 3-methyl-1,6-diphenyl-2-(3-propan-2-yloxyphenyl)pyridin-4-one |
| SMILES | Cc1c(-c2cccc(OC(C)C)c2)n(-c2ccccc2)c(-c2ccccc2)cc1=O |
| InChI | InChI=1S/C27H25NO2/c1-19(2)30-24-16-10-13-22(17-24)27-20(3)26(29)18-25(21-11-6-4-7-12-21)28(27)23-14-8-5-9-15-23/h4-19H,1-3H3 |
| InChIKey | LXUXQEGYNVRYMI-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |