C26H23NO — CID 14303765
2-(2,3-dimethylphenyl)-3-methyl-1,6-diphenylpyridin-4-one (PubChem CID 14303765) has the molecular formula C26H23NO and a molecular weight of 365.48 g/mol. Its IUPAC name is 2-(2,3-dimethylphenyl)-3-methyl-1,6-diphenylpyridin-4-one.
| Compound Name | 2-(2,3-dimethylphenyl)-3-methyl-1,6-diphenylpyridin-4-one |
|---|---|
| PubChem CID | 14303765 |
| Molecular Formula | C26H23NO |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 2-(2,3-dimethylphenyl)-3-methyl-1,6-diphenylpyridin-4-one |
| SMILES | Cc1cccc(-c2c(C)c(=O)cc(-c3ccccc3)n2-c2ccccc2)c1C |
| InChI | InChI=1S/C26H23NO/c1-18-11-10-16-23(19(18)2)26-20(3)25(28)17-24(21-12-6-4-7-13-21)27(26)22-14-8-5-9-15-22/h4-17H,1-3H3 |
| InChIKey | NITIJSORSUYKMU-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |