C23H23NO — CID 14621245
2-cyclopentyl-3-methyl-1,6-diphenylpyridin-4-one (PubChem CID 14621245) has the molecular formula C23H23NO and a molecular weight of 329.44 g/mol. Its IUPAC name is 2-cyclopentyl-3-methyl-1,6-diphenylpyridin-4-one.
| Compound Name | 2-cyclopentyl-3-methyl-1,6-diphenylpyridin-4-one |
|---|---|
| PubChem CID | 14621245 |
| Molecular Formula | C23H23NO |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 2-cyclopentyl-3-methyl-1,6-diphenylpyridin-4-one |
| SMILES | Cc1c(C2CCCC2)n(-c2ccccc2)c(-c2ccccc2)cc1=O |
| InChI | InChI=1S/C23H23NO/c1-17-22(25)16-21(18-10-4-2-5-11-18)24(20-14-6-3-7-15-20)23(17)19-12-8-9-13-19/h2-7,10-11,14-16,19H,8-9,12-13H2,1H3 |
| InChIKey | YXLHAGHSTMOCMJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |