C26H23NO3 — CID 14303546
1-(3,5-dimethoxyphenyl)-3-methyl-2,6-diphenylpyridin-4-one (PubChem CID 14303546) has the molecular formula C26H23NO3 and a molecular weight of 397.47 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-methyl-2,6-diphenylpyridin-4-one.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-methyl-2,6-diphenylpyridin-4-one |
|---|---|
| PubChem CID | 14303546 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-methyl-2,6-diphenylpyridin-4-one |
| SMILES | COc1cc(OC)cc(-n2c(-c3ccccc3)cc(=O)c(C)c2-c2ccccc2)c1 |
| InChI | InChI=1S/C26H23NO3/c1-18-25(28)17-24(19-10-6-4-7-11-19)27(26(18)20-12-8-5-9-13-20)21-14-22(29-2)16-23(15-21)30-3/h4-17H,1-3H3 |
| InChIKey | UKHZLGMGANTLBZ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |